C23H24O5 — CID 7965941
[2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 7965941) has the molecular formula C23H24O5 and a molecular weight of 380.44 g/mol. Its IUPAC name is [2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7965941 |
| Molecular Formula | C23H24O5 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | [2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCC(=O)c2ccc3c(c2)CCCC3)cc1OC |
| InChI | InChI=1S/C23H24O5/c1-26-21-11-7-16(13-22(21)27-2)8-12-23(25)28-15-20(24)19-10-9-17-5-3-4-6-18(17)14-19/h7-14H,3-6,15H2,1-2H3/b12-8+ |
| InChIKey | QSUGZNJKTZVVMK-XYOKQWHBSA-N |
| XLogP | 4.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|