C21H22N2O5S — CID 8571367
4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]butanamide (PubChem CID 8571367) has the molecular formula C21H22N2O5S and a molecular weight of 414.48 g/mol. Its IUPAC name is 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]butanamide.
| Compound Name | 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]butanamide |
|---|---|
| PubChem CID | 8571367 |
| Molecular Formula | C21H22N2O5S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]butanamide |
| SMILES | C[C@@]1(NC(=O)CCCN2C(=O)c3cccc4cccc(c34)C2=O)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H22N2O5S/c1-21(10-12-29(27,28)13-21)22-17(24)9-4-11-23-19(25)15-7-2-5-14-6-3-8-16(18(14)15)20(23)26/h2-3,5-8H,4,9-13H2,1H3,(H,22,24)/t21-/m1/s1 |
| InChIKey | KPKZRDFXQWZJAB-OAQYLSRUSA-N |
| XLogP | 1.91 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|