C23H23N3O4 — CID 8572554
(5R)-3-[2-[(3R)-3-methyl-2-oxo-1,3-dihydroindol-5-yl]-2-oxoethyl]-5-phenyl-5-propylimidazolidine-2,4-dione (PubChem CID 8572554) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is (5R)-3-[2-[(3R)-3-methyl-2-oxo-1,3-dihydroindol-5-yl]-2-oxoethyl]-5-phenyl-5-propylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[2-[(3R)-3-methyl-2-oxo-1,3-dihydroindol-5-yl]-2-oxoethyl]-5-phenyl-5-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 8572554 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | (5R)-3-[2-[(3R)-3-methyl-2-oxo-1,3-dihydroindol-5-yl]-2-oxoethyl]-5-phenyl-5-propylimidazolidine-2,4-dione |
| SMILES | CCC[C@]1(c2ccccc2)NC(=O)N(CC(=O)c2ccc3c(c2)[C@@H](C)C(=O)N3)C1=O |
| InChI | InChI=1S/C23H23N3O4/c1-3-11-23(16-7-5-4-6-8-16)21(29)26(22(30)25-23)13-19(27)15-9-10-18-17(12-15)14(2)20(28)24-18/h4-10,12,14H,3,11,13H2,1-2H3,(H,24,28)(H,25,30)/t14-,23-/m1/s1 |
| InChIKey | XMGSMSAREQETES-QKFKETGDSA-N |
| XLogP | 3.17 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|