C24H21N3O2S — CID 8573295
2-[5-(4-methylphenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]-N-phenyl-N-prop-2-enylacetamide (PubChem CID 8573295) has the molecular formula C24H21N3O2S and a molecular weight of 415.52 g/mol. Its IUPAC name is 2-[5-(4-methylphenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]-N-phenyl-N-prop-2-enylacetamide.
| Compound Name | 2-[5-(4-methylphenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]-N-phenyl-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 8573295 |
| Molecular Formula | C24H21N3O2S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 2-[5-(4-methylphenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]-N-phenyl-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)Cn1cnc2scc(-c3ccc(C)cc3)c2c1=O)c1ccccc1 |
| InChI | InChI=1S/C24H21N3O2S/c1-3-13-27(19-7-5-4-6-8-19)21(28)14-26-16-25-23-22(24(26)29)20(15-30-23)18-11-9-17(2)10-12-18/h3-12,15-16H,1,13-14H2,2H3 |
| InChIKey | KFFPFPLHDVZDAW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|