C20H22N4OS2 — CID 8574061
N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-(thiophen-2-ylmethylsulfanyl)acetamide (PubChem CID 8574061) has the molecular formula C20H22N4OS2 and a molecular weight of 398.56 g/mol. Its IUPAC name is N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-(thiophen-2-ylmethylsulfanyl)acetamide.
| Compound Name | N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-(thiophen-2-ylmethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 8574061 |
| Molecular Formula | C20H22N4OS2 |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-(thiophen-2-ylmethylsulfanyl)acetamide |
| SMILES | O=C(CSCc1cccs1)Nc1cccc(-c2nnc3n2CCCCC3)c1 |
| InChI | InChI=1S/C20H22N4OS2/c25-19(14-26-13-17-8-5-11-27-17)21-16-7-4-6-15(12-16)20-23-22-18-9-2-1-3-10-24(18)20/h4-8,11-12H,1-3,9-10,13-14H2,(H,21,25) |
| InChIKey | XJRIBIOQTZFHRQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |