C20H23NO5S — CID 8576767
[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 7-methoxy-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate (PubChem CID 8576767) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 7-methoxy-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate.
| Compound Name | [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 7-methoxy-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate |
|---|---|
| PubChem CID | 8576767 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 7-methoxy-4,5-dihydrobenzo[g][1]benzothiole-2-carboxylate |
| SMILES | COCCNC(=O)[C@H](C)OC(=O)c1cc2c(s1)-c1ccc(OC)cc1CC2 |
| InChI | InChI=1S/C20H23NO5S/c1-12(19(22)21-8-9-24-2)26-20(23)17-11-14-5-4-13-10-15(25-3)6-7-16(13)18(14)27-17/h6-7,10-12H,4-5,8-9H2,1-3H3,(H,21,22)/t12-/m0/s1 |
| InChIKey | IRIRVJAWRUBIAP-LBPRGKRZSA-N |
| XLogP | 2.83 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|