C17H14F2N2O3 — CID 8578040
4-[(2R)-2-(3,4-difluorophenoxy)propanoyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 8578040) has the molecular formula C17H14F2N2O3 and a molecular weight of 332.31 g/mol. Its IUPAC name is 4-[(2R)-2-(3,4-difluorophenoxy)propanoyl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[(2R)-2-(3,4-difluorophenoxy)propanoyl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 8578040 |
| Molecular Formula | C17H14F2N2O3 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 4-[(2R)-2-(3,4-difluorophenoxy)propanoyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | C[C@@H](Oc1ccc(F)c(F)c1)C(=O)N1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C17H14F2N2O3/c1-10(24-11-6-7-12(18)13(19)8-11)17(23)21-9-16(22)20-14-4-2-3-5-15(14)21/h2-8,10H,9H2,1H3,(H,20,22)/t10-/m1/s1 |
| InChIKey | MCBJCKOUQXSLAO-SNVBAGLBSA-N |
| XLogP | 2.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |