C13H26N3O2+ — CID 8583094
2-[(2R)-2-methylpiperidin-1-ium-1-yl]-N-(2-methylpropylcarbamoyl)acetamide (PubChem CID 8583094) has the molecular formula C13H26N3O2+ and a molecular weight of 256.37 g/mol. Its IUPAC name is 2-[(2R)-2-methylpiperidin-1-ium-1-yl]-N-(2-methylpropylcarbamoyl)acetamide.
| Compound Name | 2-[(2R)-2-methylpiperidin-1-ium-1-yl]-N-(2-methylpropylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 8583094 |
| Molecular Formula | C13H26N3O2+ |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 2-[(2R)-2-methylpiperidin-1-ium-1-yl]-N-(2-methylpropylcarbamoyl)acetamide |
| SMILES | CC(C)CNC(=O)NC(=O)C[NH+]1CCCC[C@H]1C |
| InChI | InChI=1S/C13H25N3O2/c1-10(2)8-14-13(18)15-12(17)9-16-7-5-4-6-11(16)3/h10-11H,4-9H2,1-3H3,(H2,14,15,17,18)/p+1/t11-/m1/s1 |
| InChIKey | XZZUMZKCHBASNK-LLVKDONJSA-O |
| XLogP | -0.07 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |