C17H24N2O3 — CID 8583347
ethyl 2-[[2-[(2S)-2-methylpiperidin-1-yl]acetyl]amino]benzoate (PubChem CID 8583347) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is ethyl 2-[[2-[(2S)-2-methylpiperidin-1-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[(2S)-2-methylpiperidin-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 8583347 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | ethyl 2-[[2-[(2S)-2-methylpiperidin-1-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CN1CCCC[C@@H]1C |
| InChI | InChI=1S/C17H24N2O3/c1-3-22-17(21)14-9-4-5-10-15(14)18-16(20)12-19-11-7-6-8-13(19)2/h4-5,9-10,13H,3,6-8,11-12H2,1-2H3,(H,18,20)/t13-/m0/s1 |
| InChIKey | TXHACTXJXKEETI-ZDUSSCGKSA-N |
| XLogP | 2.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |