C24H33N3O3 — CID 8584049
2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 8584049) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 8584049 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | COc1ccc(CCN(C)CC(=O)Nc2ccc(N3CCCCC3)cc2)cc1OC |
| InChI | InChI=1S/C24H33N3O3/c1-26(16-13-19-7-12-22(29-2)23(17-19)30-3)18-24(28)25-20-8-10-21(11-9-20)27-14-5-4-6-15-27/h7-12,17H,4-6,13-16,18H2,1-3H3,(H,25,28) |
| InChIKey | UKSWHHAXJAYZAF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|