C18H18F2N4O3 — CID 8590859
N-(3,4-difluorophenyl)-2-[4-(4-nitrophenyl)piperazin-1-yl]acetamide (PubChem CID 8590859) has the molecular formula C18H18F2N4O3 and a molecular weight of 376.36 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-[4-(4-nitrophenyl)piperazin-1-yl]acetamide.
| Compound Name | N-(3,4-difluorophenyl)-2-[4-(4-nitrophenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8590859 |
| Molecular Formula | C18H18F2N4O3 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-[4-(4-nitrophenyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(c2ccc([N+](=O)[O-])cc2)CC1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H18F2N4O3/c19-16-6-1-13(11-17(16)20)21-18(25)12-22-7-9-23(10-8-22)14-2-4-15(5-3-14)24(26)27/h1-6,11H,7-10,12H2,(H,21,25) |
| InChIKey | IFXAGSQTOSSWSQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|