C19H20Cl2N3+ — CID 8598898
(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methyl-[(1R)-1-(2-chlorophenyl)ethyl]azanium (PubChem CID 8598898) has the molecular formula C19H20Cl2N3+ and a molecular weight of 361.30 g/mol. Its IUPAC name is (5-chloro-3-methyl-1-phenylpyrazol-4-yl)methyl-[(1R)-1-(2-chlorophenyl)ethyl]azanium.
| Compound Name | (5-chloro-3-methyl-1-phenylpyrazol-4-yl)methyl-[(1R)-1-(2-chlorophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 8598898 |
| Molecular Formula | C19H20Cl2N3+ |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (5-chloro-3-methyl-1-phenylpyrazol-4-yl)methyl-[(1R)-1-(2-chlorophenyl)ethyl]azanium |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1C[NH2+][C@H](C)c1ccccc1Cl |
| InChI | InChI=1S/C19H19Cl2N3/c1-13(16-10-6-7-11-18(16)20)22-12-17-14(2)23-24(19(17)21)15-8-4-3-5-9-15/h3-11,13,22H,12H2,1-2H3/p+1/t13-/m1/s1 |
| InChIKey | XMCYUUALKRZNNC-CYBMUJFWSA-O |
| XLogP | 4.31 |
| TPSA | 34.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |