C25H21NO2 — CID 86000525
5-ethyl-2,2-diphenyl-3H-furo[3,2-c]quinolin-4-one (PubChem CID 86000525) has the molecular formula C25H21NO2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 5-ethyl-2,2-diphenyl-3H-furo[3,2-c]quinolin-4-one.
| Compound Name | 5-ethyl-2,2-diphenyl-3H-furo[3,2-c]quinolin-4-one |
|---|---|
| PubChem CID | 86000525 |
| Molecular Formula | C25H21NO2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 5-ethyl-2,2-diphenyl-3H-furo[3,2-c]quinolin-4-one |
| SMILES | CCn1c(=O)c2c(c3ccccc31)OC(c1ccccc1)(c1ccccc1)C2 |
| InChI | InChI=1S/C25H21NO2/c1-2-26-22-16-10-9-15-20(22)23-21(24(26)27)17-25(28-23,18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-16H,2,17H2,1H3 |
| InChIKey | GRNKDQFPDNUOJA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |