C14H16N2O3 — CID 86002223
8-amino-4-(2-methylpropoxy)quinoline-2-carboxylic acid (PubChem CID 86002223) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 8-amino-4-(2-methylpropoxy)quinoline-2-carboxylic acid.
| Compound Name | 8-amino-4-(2-methylpropoxy)quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 86002223 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 8-amino-4-(2-methylpropoxy)quinoline-2-carboxylic acid |
| SMILES | CC(C)COc1cc(C(=O)O)nc2c(N)cccc12 |
| InChI | InChI=1S/C14H16N2O3/c1-8(2)7-19-12-6-11(14(17)18)16-13-9(12)4-3-5-10(13)15/h3-6,8H,7,15H2,1-2H3,(H,17,18) |
| InChIKey | UQMUZAYVJKDBFB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|