dimethyl 2,6-dimethyloct-2-enedioate

C12H20O4 — CID 86015235

IUPACdimethyl 2,6-dimethyloct-2-enedioate
SMILESCOC(=O)CC(C)CCC=C(C)C(=O)OC
InChIInChI=1S/C12H20O4/c1-9(8-11(13)15-3)6-5-7-10(2)12(14)16-4/h7,9H,5-6,8H2,1-4H3
InChIKeyOJVBPGZPYLHYGX-UHFFFAOYSA-N
MW228.29 g/mol
LogP2.09
Rot. Bonds6

About dimethyl 2,6-dimethyloct-2-enedioate

dimethyl 2,6-dimethyloct-2-enedioate (PubChem CID 86015235) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is dimethyl 2,6-dimethyloct-2-enedioate.

Molecular Properties

Compound Namedimethyl 2,6-dimethyloct-2-enedioate
PubChem CID86015235
Molecular FormulaC12H20O4
Molecular Weight228.29 g/mol
Exact Mass228.14
IUPAC Namedimethyl 2,6-dimethyloct-2-enedioate
SMILESCOC(=O)CC(C)CCC=C(C)C(=O)OC
InChIInChI=1S/C12H20O4/c1-9(8-11(13)15-3)6-5-7-10(2)12(14)16-4/h7,9H,5-6,8H2,1-4H3
InChIKeyOJVBPGZPYLHYGX-UHFFFAOYSA-N
XLogP2.09
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.29
LogP ≤ 52.09
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze dimethyl 2,6-dimethyloct-2-enedioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Citronellyl tiglate
CID 6386037
Methyl rhodinolate
CID 61290
2-Butenoic acid, 3,7-dimethyl-6-octen-1-yl ester
CID 5365882
Methyl cyclopent-1-ene-1-carboxylate
CID 549129
Sinodor
CID 89382
1,3-Cyclohexadiene-1-carboxylic acid, 4,6,6-trimethyl-, ethyl ester
CID 68524240
Methyl 4-(prop-1-en-2-yl)cyclohex-1-enecarboxylate
CID 4453437
Dimethyl 2-methyl-5-methyleneadipate
CID 107295
Methyl 2-propylpent-2-enoate
CID 10241045
Methyl (4S)-4-(prop-1-en-2-yl)cyclohex-1-ene-1-carboxylate
CID 14159029
(Z)-3-methoxycarbonyl-4-methylhex-2-enoic acid
CID 155543307
Vibralactone L
CID 131849277

Frequently Asked Questions

What is the IUPAC name of dimethyl 2,6-dimethyloct-2-enedioate?
The IUPAC name of dimethyl 2,6-dimethyloct-2-enedioate (CID 86015235) is dimethyl 2,6-dimethyloct-2-enedioate.
What is the SMILES notation for dimethyl 2,6-dimethyloct-2-enedioate?
The canonical SMILES for dimethyl 2,6-dimethyloct-2-enedioate is COC(=O)CC(C)CCC=C(C)C(=O)OC.
What is the InChIKey of dimethyl 2,6-dimethyloct-2-enedioate?
The InChIKey is OJVBPGZPYLHYGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c1-9(8-11(13)15-3)6-5-7-10(2)12(14)16-4/h7,9H,5-6,8H2,1-4H3.
What are the key properties of dimethyl 2,6-dimethyloct-2-enedioate?
dimethyl 2,6-dimethyloct-2-enedioate has a molecular weight of 228.29 g/mol, XLogP of 2.09, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2,6-dimethyloct-2-enedioate is sourced from PubChem (CID 86015235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).