About 2-methoxy-4,6-di(propan-2-yloxy)pyrimidine
2-methoxy-4,6-di(propan-2-yloxy)pyrimidine (PubChem CID 86016297) has the molecular formula C11H18N2O3
and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-methoxy-4,6-di(propan-2-yloxy)pyrimidine.
Molecular Properties
| Compound Name | 2-methoxy-4,6-di(propan-2-yloxy)pyrimidine |
| PubChem CID | 86016297 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 2-methoxy-4,6-di(propan-2-yloxy)pyrimidine |
| SMILES | COc1nc(OC(C)C)cc(OC(C)C)n1 |
| InChI | InChI=1S/C11H18N2O3/c1-7(2)15-9-6-10(16-8(3)4)13-11(12-9)14-5/h6-8H,1-5H3 |
| InChIKey | NCAQZVAMVMVPEC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methoxy-4,6-di(propan-2-yloxy)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-4,6-di(propan-2-yloxy)pyrimidine?
The IUPAC name of 2-methoxy-4,6-di(propan-2-yloxy)pyrimidine (CID 86016297) is 2-methoxy-4,6-di(propan-2-yloxy)pyrimidine.
What is the SMILES notation for 2-methoxy-4,6-di(propan-2-yloxy)pyrimidine?
The canonical SMILES for 2-methoxy-4,6-di(propan-2-yloxy)pyrimidine is COc1nc(OC(C)C)cc(OC(C)C)n1.
What is the InChIKey of 2-methoxy-4,6-di(propan-2-yloxy)pyrimidine?
The InChIKey is NCAQZVAMVMVPEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3/c1-7(2)15-9-6-10(16-8(3)4)13-11(12-9)14-5/h6-8H,1-5H3.
What are the key properties of 2-methoxy-4,6-di(propan-2-yloxy)pyrimidine?
2-methoxy-4,6-di(propan-2-yloxy)pyrimidine has a molecular weight of 226.28 g/mol, XLogP of 2.06, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-4,6-di(propan-2-yloxy)pyrimidine is sourced from PubChem (CID 86016297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).