C12H25BO3 — CID 86018565
2-(2-butoxyethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 86018565) has the molecular formula C12H25BO3 and a molecular weight of 228.14 g/mol. Its IUPAC name is 2-(2-butoxyethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(2-butoxyethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 86018565 |
| Molecular Formula | C12H25BO3 |
| Molecular Weight | 228.14 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 2-(2-butoxyethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCOCCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C12H25BO3/c1-6-7-9-14-10-8-13-15-11(2,3)12(4,5)16-13/h6-10H2,1-5H3 |
| InChIKey | WJMSYMWNJZULGK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.14 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|