C41H37N3O5S2 — CID 86030959
2-[(3-ethyl-5-phenyl-1,3-benzoxazol-3-ium-2-yl)methylidene]-5-[2-(1-methylquinolin-4-ylidene)ethylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one;4-methylbenzenesulfonate (PubChem CID 86030959) has the molecular formula C41H37N3O5S2 and a molecular weight of 715.90 g/mol. Its IUPAC name is 2-[(3-ethyl-5-phenyl-1,3-benzoxazol-3-ium-2-yl)methylidene]-5-[2-(1-methylquinolin-4-ylidene)ethylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one;4-methylbenzenesulfonate.
| Compound Name | 2-[(3-ethyl-5-phenyl-1,3-benzoxazol-3-ium-2-yl)methylidene]-5-[2-(1-methylquinolin-4-ylidene)ethylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86030959 |
| Molecular Formula | C41H37N3O5S2 |
| Molecular Weight | 715.90 g/mol |
| Exact Mass | 715.22 |
| IUPAC Name | 2-[(3-ethyl-5-phenyl-1,3-benzoxazol-3-ium-2-yl)methylidene]-5-[2-(1-methylquinolin-4-ylidene)ethylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one;4-methylbenzenesulfonate |
| SMILES | C=CCn1c(=Cc2oc3ccc(-c4ccccc4)cc3[n+]2CC)sc(=CC=C2C=CN(C)c3ccccc32)c1=O.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C34H30N3O2S.C7H8O3S/c1-4-20-37-33(40-31(34(37)38)18-16-25-19-21-35(3)28-14-10-9-13-27(25)28)23-32-36(5-2)29-22-26(15-17-30(29)39-32)24-11-7-6-8-12-24;1-6-2-4-7(5-3-6)11(8,9)10/h4,6-19,21-23H,1,5,20H2,2-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | DONWKFNSWNNLDA-UHFFFAOYSA-M |
| XLogP | 6.37 |
| TPSA | 99.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.90 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|