C18H22F2O — CID 86035820
6,7-difluoro-2-(4-propylcyclohexyl)-2,3-dihydroinden-1-one (PubChem CID 86035820) has the molecular formula C18H22F2O and a molecular weight of 292.37 g/mol. Its IUPAC name is 6,7-difluoro-2-(4-propylcyclohexyl)-2,3-dihydroinden-1-one.
| Compound Name | 6,7-difluoro-2-(4-propylcyclohexyl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 86035820 |
| Molecular Formula | C18H22F2O |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 6,7-difluoro-2-(4-propylcyclohexyl)-2,3-dihydroinden-1-one |
| SMILES | CCCC1CCC(C2Cc3ccc(F)c(F)c3C2=O)CC1 |
| InChI | InChI=1S/C18H22F2O/c1-2-3-11-4-6-12(7-5-11)14-10-13-8-9-15(19)17(20)16(13)18(14)21/h8-9,11-12,14H,2-7,10H2,1H3 |
| InChIKey | DNKNLTHFKRBCKH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |