C7H15N5 — CID 86039125
N'-[(5-amino-1-methylpyrazol-4-yl)methyl]ethane-1,2-diamine (PubChem CID 86039125) has the molecular formula C7H15N5 and a molecular weight of 169.23 g/mol. Its IUPAC name is N'-[(5-amino-1-methylpyrazol-4-yl)methyl]ethane-1,2-diamine.
| Compound Name | N'-[(5-amino-1-methylpyrazol-4-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 86039125 |
| Molecular Formula | C7H15N5 |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | N'-[(5-amino-1-methylpyrazol-4-yl)methyl]ethane-1,2-diamine |
| SMILES | Cn1ncc(CNCCN)c1N |
| InChI | InChI=1S/C7H15N5/c1-12-7(9)6(5-11-12)4-10-3-2-8/h5,10H,2-4,8-9H2,1H3 |
| InChIKey | HLTPYHJDJIOZGF-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|