C14H29NO5Si — CID 86042493
triethoxy-[3-(2,3,5,6-tetrahydro-[1,3]oxazolo[2,3-b][1,3]oxazol-7a-yl)propyl]silane (PubChem CID 86042493) has the molecular formula C14H29NO5Si and a molecular weight of 319.47 g/mol. Its IUPAC name is triethoxy-[3-(2,3,5,6-tetrahydro-[1,3]oxazolo[2,3-b][1,3]oxazol-7a-yl)propyl]silane.
| Compound Name | triethoxy-[3-(2,3,5,6-tetrahydro-[1,3]oxazolo[2,3-b][1,3]oxazol-7a-yl)propyl]silane |
|---|---|
| PubChem CID | 86042493 |
| Molecular Formula | C14H29NO5Si |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | triethoxy-[3-(2,3,5,6-tetrahydro-[1,3]oxazolo[2,3-b][1,3]oxazol-7a-yl)propyl]silane |
| SMILES | CCO[Si](CCCC12OCCN1CCO2)(OCC)OCC |
| InChI | InChI=1S/C14H29NO5Si/c1-4-18-21(19-5-2,20-6-3)13-7-8-14-15(9-11-16-14)10-12-17-14/h4-13H2,1-3H3 |
| InChIKey | MVONIMLJWJTMPJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|