C20H16INO2S2 — CID 86053256
3-iodo-1-(4-methylphenyl)sulfonyl-4-thiophen-3-yl-2H-quinoline (PubChem CID 86053256) has the molecular formula C20H16INO2S2 and a molecular weight of 493.39 g/mol. Its IUPAC name is 3-iodo-1-(4-methylphenyl)sulfonyl-4-thiophen-3-yl-2H-quinoline.
| Compound Name | 3-iodo-1-(4-methylphenyl)sulfonyl-4-thiophen-3-yl-2H-quinoline |
|---|---|
| PubChem CID | 86053256 |
| Molecular Formula | C20H16INO2S2 |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 492.97 |
| IUPAC Name | 3-iodo-1-(4-methylphenyl)sulfonyl-4-thiophen-3-yl-2H-quinoline |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(I)=C(c3ccsc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C20H16INO2S2/c1-14-6-8-16(9-7-14)26(23,24)22-12-18(21)20(15-10-11-25-13-15)17-4-2-3-5-19(17)22/h2-11,13H,12H2,1H3 |
| InChIKey | JTJCIOYYEPRULX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|