C15H14Cl2N2O2S — CID 8605332
N-[(1R)-1-(3,4-dichlorophenyl)ethyl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide (PubChem CID 8605332) has the molecular formula C15H14Cl2N2O2S and a molecular weight of 357.26 g/mol. Its IUPAC name is N-[(1R)-1-(3,4-dichlorophenyl)ethyl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide.
| Compound Name | N-[(1R)-1-(3,4-dichlorophenyl)ethyl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 8605332 |
| Molecular Formula | C15H14Cl2N2O2S |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | N-[(1R)-1-(3,4-dichlorophenyl)ethyl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylacetamide |
| SMILES | C[C@@H](NC(=O)CSc1cccc[n+]1[O-])c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H14Cl2N2O2S/c1-10(11-5-6-12(16)13(17)8-11)18-14(20)9-22-15-4-2-3-7-19(15)21/h2-8,10H,9H2,1H3,(H,18,20)/t10-/m1/s1 |
| InChIKey | RGMJWAITVCCZOC-SNVBAGLBSA-N |
| XLogP | 3.60 |
| TPSA | 56.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|