C17H26N4O2 — CID 86053413
2-pentyl-1-(4-pyrazin-2-ylpiperazin-1-yl)butane-1,3-dione (PubChem CID 86053413) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-pentyl-1-(4-pyrazin-2-ylpiperazin-1-yl)butane-1,3-dione.
| Compound Name | 2-pentyl-1-(4-pyrazin-2-ylpiperazin-1-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 86053413 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 2-pentyl-1-(4-pyrazin-2-ylpiperazin-1-yl)butane-1,3-dione |
| SMILES | CCCCCC(C(C)=O)C(=O)N1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C17H26N4O2/c1-3-4-5-6-15(14(2)22)17(23)21-11-9-20(10-12-21)16-13-18-7-8-19-16/h7-8,13,15H,3-6,9-12H2,1-2H3 |
| InChIKey | ZLVHPNVYCINPMG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|