C14H17NO5S — CID 86056376
[1-(4-methylphenyl)sulfonyl-5-oxopyrrolidin-2-yl]methyl acetate (PubChem CID 86056376) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is [1-(4-methylphenyl)sulfonyl-5-oxopyrrolidin-2-yl]methyl acetate.
| Compound Name | [1-(4-methylphenyl)sulfonyl-5-oxopyrrolidin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 86056376 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | [1-(4-methylphenyl)sulfonyl-5-oxopyrrolidin-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1CCC(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H17NO5S/c1-10-3-6-13(7-4-10)21(18,19)15-12(5-8-14(15)17)9-20-11(2)16/h3-4,6-7,12H,5,8-9H2,1-2H3 |
| InChIKey | FLFWYUHDYGBBPL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |