C19H13FN2O2S — CID 8607134
[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 1H-indole-3-carboxylate (PubChem CID 8607134) has the molecular formula C19H13FN2O2S and a molecular weight of 352.39 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 1H-indole-3-carboxylate.
| Compound Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 8607134 |
| Molecular Formula | C19H13FN2O2S |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 1H-indole-3-carboxylate |
| SMILES | O=C(OCc1csc(-c2ccc(F)cc2)n1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H13FN2O2S/c20-13-7-5-12(6-8-13)18-22-14(11-25-18)10-24-19(23)16-9-21-17-4-2-1-3-15(16)17/h1-9,11,21H,10H2 |
| InChIKey | VURGWKSICWSTKZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |