C12H23NO3 — CID 86074424
ethyl 3-methoxyimino-4,5-dimethylheptanoate (PubChem CID 86074424) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is ethyl 3-methoxyimino-4,5-dimethylheptanoate.
| Compound Name | ethyl 3-methoxyimino-4,5-dimethylheptanoate |
|---|---|
| PubChem CID | 86074424 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | ethyl 3-methoxyimino-4,5-dimethylheptanoate |
| SMILES | CCOC(=O)CC(=NOC)C(C)C(C)CC |
| InChI | InChI=1S/C12H23NO3/c1-6-9(3)10(4)11(13-15-5)8-12(14)16-7-2/h9-10H,6-8H2,1-5H3 |
| InChIKey | ZRGKAPLZFAFGBF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|