C12H15F3O — CID 86077598
3-(1-but-2-ynoxy-2,2,2-trifluoroethyl)cyclohexene (PubChem CID 86077598) has the molecular formula C12H15F3O and a molecular weight of 232.24 g/mol. Its IUPAC name is 3-(1-but-2-ynoxy-2,2,2-trifluoroethyl)cyclohexene.
| Compound Name | 3-(1-but-2-ynoxy-2,2,2-trifluoroethyl)cyclohexene |
|---|---|
| PubChem CID | 86077598 |
| Molecular Formula | C12H15F3O |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 3-(1-but-2-ynoxy-2,2,2-trifluoroethyl)cyclohexene |
| SMILES | CC#CCOC(C1C=CCCC1)C(F)(F)F |
| InChI | InChI=1S/C12H15F3O/c1-2-3-9-16-11(12(13,14)15)10-7-5-4-6-8-10/h5,7,10-11H,4,6,8-9H2,1H3 |
| InChIKey | XPWQTICCGGVQBJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|