C17H16F2Si — CID 86078696
[4-[2-(3,5-difluorophenyl)ethynyl]phenyl]-trimethylsilane (PubChem CID 86078696) has the molecular formula C17H16F2Si and a molecular weight of 286.40 g/mol. Its IUPAC name is [4-[2-(3,5-difluorophenyl)ethynyl]phenyl]-trimethylsilane.
| Compound Name | [4-[2-(3,5-difluorophenyl)ethynyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 86078696 |
| Molecular Formula | C17H16F2Si |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | [4-[2-(3,5-difluorophenyl)ethynyl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(C#Cc2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C17H16F2Si/c1-20(2,3)17-8-6-13(7-9-17)4-5-14-10-15(18)12-16(19)11-14/h6-12H,1-3H3 |
| InChIKey | ZRRKBBRZHOXQGN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|