C14H11ClF2N2 — CID 18454768
2-[2-(3,5-difluorophenyl)ethynyl]-6-methylpyridin-3-amine;hydrochloride (PubChem CID 18454768) has the molecular formula C14H11ClF2N2 and a molecular weight of 280.71 g/mol. Its IUPAC name is 2-[2-(3,5-difluorophenyl)ethynyl]-6-methylpyridin-3-amine;hydrochloride.
| Compound Name | 2-[2-(3,5-difluorophenyl)ethynyl]-6-methylpyridin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 18454768 |
| Molecular Formula | C14H11ClF2N2 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 2-[2-(3,5-difluorophenyl)ethynyl]-6-methylpyridin-3-amine;hydrochloride |
| SMILES | Cc1ccc(N)c(C#Cc2cc(F)cc(F)c2)n1.Cl |
| InChI | InChI=1S/C14H10F2N2.ClH/c1-9-2-4-13(17)14(18-9)5-3-10-6-11(15)8-12(16)7-10;/h2,4,6-8H,17H2,1H3;1H |
| InChIKey | GGAGVKHTVDEPRG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|