C14H15NO5 — CID 8608213
[(3R)-2-oxooxolan-3-yl] 2-(4-acetamidophenyl)acetate (PubChem CID 8608213) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is [(3R)-2-oxooxolan-3-yl] 2-(4-acetamidophenyl)acetate.
| Compound Name | [(3R)-2-oxooxolan-3-yl] 2-(4-acetamidophenyl)acetate |
|---|---|
| PubChem CID | 8608213 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | [(3R)-2-oxooxolan-3-yl] 2-(4-acetamidophenyl)acetate |
| SMILES | CC(=O)Nc1ccc(CC(=O)O[C@@H]2CCOC2=O)cc1 |
| InChI | InChI=1S/C14H15NO5/c1-9(16)15-11-4-2-10(3-5-11)8-13(17)20-12-6-7-19-14(12)18/h2-5,12H,6-8H2,1H3,(H,15,16)/t12-/m1/s1 |
| InChIKey | GPCOCAGHDYIHAR-GFCCVEGCSA-N |
| XLogP | 1.05 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |