C17H22N2O7S — CID 7168813
[(3S)-2-oxooxolan-3-yl] 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate (PubChem CID 7168813) has the molecular formula C17H22N2O7S and a molecular weight of 398.44 g/mol. Its IUPAC name is [(3S)-2-oxooxolan-3-yl] 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate.
| Compound Name | [(3S)-2-oxooxolan-3-yl] 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 7168813 |
| Molecular Formula | C17H22N2O7S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | [(3S)-2-oxooxolan-3-yl] 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NCC(=O)O[C@H]2CCOC2=O)cc1 |
| InChI | InChI=1S/C17H22N2O7S/c1-3-19(4-2)27(23,24)13-7-5-12(6-8-13)16(21)18-11-15(20)26-14-9-10-25-17(14)22/h5-8,14H,3-4,9-11H2,1-2H3,(H,18,21)/t14-/m0/s1 |
| InChIKey | AWWXGQVYBHMSCI-AWEZNQCLSA-N |
| XLogP | 0.31 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |