About [(3S)-2-oxooxolan-3-yl] 4-(2-methoxyethylsulfamoyl)benzoate
[(3S)-2-oxooxolan-3-yl] 4-(2-methoxyethylsulfamoyl)benzoate (PubChem CID 51928625) has the molecular formula C14H17NO7S
and a molecular weight of 343.36 g/mol. Its IUPAC name is [(3S)-2-oxooxolan-3-yl] 4-(2-methoxyethylsulfamoyl)benzoate.
Molecular Properties
| Compound Name | [(3S)-2-oxooxolan-3-yl] 4-(2-methoxyethylsulfamoyl)benzoate |
| PubChem CID | 51928625 |
| Molecular Formula | C14H17NO7S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | [(3S)-2-oxooxolan-3-yl] 4-(2-methoxyethylsulfamoyl)benzoate |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)O[C@H]2CCOC2=O)cc1 |
| InChI | InChI=1S/C14H17NO7S/c1-20-9-7-15-23(18,19)11-4-2-10(3-5-11)13(16)22-12-6-8-21-14(12)17/h2-5,12,15H,6-9H2,1H3/t12-/m0/s1 |
| InChIKey | WVFIHVMVHJMPKO-LBPRGKRZSA-N |
| XLogP | 0.08 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-2-oxooxolan-3-yl] 4-(2-methoxyethylsulfamoyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-2-oxooxolan-3-yl] 4-(2-methoxyethylsulfamoyl)benzoate?
The IUPAC name of [(3S)-2-oxooxolan-3-yl] 4-(2-methoxyethylsulfamoyl)benzoate (CID 51928625) is [(3S)-2-oxooxolan-3-yl] 4-(2-methoxyethylsulfamoyl)benzoate.
What is the SMILES notation for [(3S)-2-oxooxolan-3-yl] 4-(2-methoxyethylsulfamoyl)benzoate?
The canonical SMILES for [(3S)-2-oxooxolan-3-yl] 4-(2-methoxyethylsulfamoyl)benzoate is COCCNS(=O)(=O)c1ccc(C(=O)O[C@H]2CCOC2=O)cc1.
What is the InChIKey of [(3S)-2-oxooxolan-3-yl] 4-(2-methoxyethylsulfamoyl)benzoate?
The InChIKey is WVFIHVMVHJMPKO-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H17NO7S/c1-20-9-7-15-23(18,19)11-4-2-10(3-5-11)13(16)22-12-6-8-21-14(12)17/h2-5,12,15H,6-9H2,1H3/t12-/m0/s1.
What are the key properties of [(3S)-2-oxooxolan-3-yl] 4-(2-methoxyethylsulfamoyl)benzoate?
[(3S)-2-oxooxolan-3-yl] 4-(2-methoxyethylsulfamoyl)benzoate has a molecular weight of 343.36 g/mol, XLogP of 0.08, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-2-oxooxolan-3-yl] 4-(2-methoxyethylsulfamoyl)benzoate is sourced from PubChem (CID 51928625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).