C8H8O3 — CID 86087523
2-methylidene-5,6-dihydro-4H-furo[2,3-b]pyran-3-one (PubChem CID 86087523) has the molecular formula C8H8O3 and a molecular weight of 152.15 g/mol. Its IUPAC name is 2-methylidene-5,6-dihydro-4H-furo[2,3-b]pyran-3-one.
| Compound Name | 2-methylidene-5,6-dihydro-4H-furo[2,3-b]pyran-3-one |
|---|---|
| PubChem CID | 86087523 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 2-methylidene-5,6-dihydro-4H-furo[2,3-b]pyran-3-one |
| SMILES | C=C1OC2=C(CCCO2)C1=O |
| InChI | InChI=1S/C8H8O3/c1-5-7(9)6-3-2-4-10-8(6)11-5/h1-4H2 |
| InChIKey | PBLOCNXNKAWAMD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|