C7H8O3 — CID 86087524
5,6-dihydro-4H-furo[2,3-b]pyran-3-one (PubChem CID 86087524) has the molecular formula C7H8O3 and a molecular weight of 140.14 g/mol. Its IUPAC name is 5,6-dihydro-4H-furo[2,3-b]pyran-3-one.
| Compound Name | 5,6-dihydro-4H-furo[2,3-b]pyran-3-one |
|---|---|
| PubChem CID | 86087524 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | 5,6-dihydro-4H-furo[2,3-b]pyran-3-one |
| SMILES | O=C1COC2=C1CCCO2 |
| InChI | InChI=1S/C7H8O3/c8-6-4-10-7-5(6)2-1-3-9-7/h1-4H2 |
| InChIKey | YTUBJJKSCSXYAV-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |