C16H17NO — CID 86092672
4,4-dimethyl-2-(8-methylnaphthalen-1-yl)-5H-1,3-oxazole (PubChem CID 86092672) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is 4,4-dimethyl-2-(8-methylnaphthalen-1-yl)-5H-1,3-oxazole.
| Compound Name | 4,4-dimethyl-2-(8-methylnaphthalen-1-yl)-5H-1,3-oxazole |
|---|---|
| PubChem CID | 86092672 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 4,4-dimethyl-2-(8-methylnaphthalen-1-yl)-5H-1,3-oxazole |
| SMILES | Cc1cccc2cccc(C3=NC(C)(C)CO3)c12 |
| InChI | InChI=1S/C16H17NO/c1-11-6-4-7-12-8-5-9-13(14(11)12)15-17-16(2,3)10-18-15/h4-9H,10H2,1-3H3 |
| InChIKey | CIXAIQUABZLQBN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |