C13H23N — CID 86094387
8-ethyl-5-prop-2-enyl-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 86094387) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 8-ethyl-5-prop-2-enyl-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | 8-ethyl-5-prop-2-enyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 86094387 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 8-ethyl-5-prop-2-enyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | C=CCC1CCC(CC)C2CCCN12 |
| InChI | InChI=1S/C13H23N/c1-3-6-12-9-8-11(4-2)13-7-5-10-14(12)13/h3,11-13H,1,4-10H2,2H3 |
| InChIKey | HPJFICLOMFNDQB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|