C17H23N — CID 91726856
8-but-3-ynyl-5-[(Z)-pent-2-en-4-ynyl]-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 91726856) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is 8-but-3-ynyl-5-[(Z)-pent-2-en-4-ynyl]-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | 8-but-3-ynyl-5-[(Z)-pent-2-en-4-ynyl]-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 91726856 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 8-but-3-ynyl-5-[(Z)-pent-2-en-4-ynyl]-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | C#C/C=C\CC1CCC(CCC#C)C2CCCN12 |
| InChI | InChI=1S/C17H23N/c1-3-5-7-10-16-13-12-15(9-6-4-2)17-11-8-14-18(16)17/h1-2,5,7,15-17H,6,8-14H2/b7-5- |
| InChIKey | OKKDNJLUTGCCGP-ALCCZGGFSA-N |
| XLogP | 3.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|