C17H25NO2 — CID 163089559
1-(8-but-3-ynyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl)pent-4-yne-2,3-diol (PubChem CID 163089559) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 1-(8-but-3-ynyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl)pent-4-yne-2,3-diol.
| Compound Name | 1-(8-but-3-ynyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl)pent-4-yne-2,3-diol |
|---|---|
| PubChem CID | 163089559 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 1-(8-but-3-ynyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl)pent-4-yne-2,3-diol |
| SMILES | C#CCCC1CCC(CC(O)C(O)C#C)N2CCCC12 |
| InChI | InChI=1S/C17H25NO2/c1-3-5-7-13-9-10-14(12-17(20)16(19)4-2)18-11-6-8-15(13)18/h1-2,13-17,19-20H,5-12H2 |
| InChIKey | LGKRXMUNNVSPLB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|