C8H13N3OS — CID 86096848
2-amino-N-(2,4-dimethylthiophen-3-yl)acetohydrazide (PubChem CID 86096848) has the molecular formula C8H13N3OS and a molecular weight of 199.28 g/mol. Its IUPAC name is 2-amino-N-(2,4-dimethylthiophen-3-yl)acetohydrazide.
| Compound Name | 2-amino-N-(2,4-dimethylthiophen-3-yl)acetohydrazide |
|---|---|
| PubChem CID | 86096848 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-amino-N-(2,4-dimethylthiophen-3-yl)acetohydrazide |
| SMILES | Cc1csc(C)c1N(N)C(=O)CN |
| InChI | InChI=1S/C8H13N3OS/c1-5-4-13-6(2)8(5)11(10)7(12)3-9/h4H,3,9-10H2,1-2H3 |
| InChIKey | MQQKIUDXUNXMFP-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|