C13H16O5 — CID 86101275
2,3,10-trimethoxyspiro[4.5]deca-2,9-diene-1,4-dione (PubChem CID 86101275) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2,3,10-trimethoxyspiro[4.5]deca-2,9-diene-1,4-dione.
| Compound Name | 2,3,10-trimethoxyspiro[4.5]deca-2,9-diene-1,4-dione |
|---|---|
| PubChem CID | 86101275 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2,3,10-trimethoxyspiro[4.5]deca-2,9-diene-1,4-dione |
| SMILES | COC1=CCCCC12C(=O)C(OC)=C(OC)C2=O |
| InChI | InChI=1S/C13H16O5/c1-16-8-6-4-5-7-13(8)11(14)9(17-2)10(18-3)12(13)15/h6H,4-5,7H2,1-3H3 |
| InChIKey | DPZNBGVTXLXDOA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|