C17H24O5 — CID 102153607
(6R)-2,3,10-trimethoxy-6-methyl-9-propan-2-ylspiro[4.5]deca-2,9-diene-1,4-dione (PubChem CID 102153607) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is (6R)-2,3,10-trimethoxy-6-methyl-9-propan-2-ylspiro[4.5]deca-2,9-diene-1,4-dione.
| Compound Name | (6R)-2,3,10-trimethoxy-6-methyl-9-propan-2-ylspiro[4.5]deca-2,9-diene-1,4-dione |
|---|---|
| PubChem CID | 102153607 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (6R)-2,3,10-trimethoxy-6-methyl-9-propan-2-ylspiro[4.5]deca-2,9-diene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C2(C1=O)C(OC)=C(C(C)C)CC[C@H]2C |
| InChI | InChI=1S/C17H24O5/c1-9(2)11-8-7-10(3)17(16(11)22-6)14(18)12(20-4)13(21-5)15(17)19/h9-10H,7-8H2,1-6H3/t10-/m1/s1 |
| InChIKey | UEPVUYHPFBNWEZ-SNVBAGLBSA-N |
| XLogP | 2.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|