C10H10BrN3O — CID 86116848
N-[2-(3-bromophenyl)-3,4-dihydropyrazol-5-yl]formamide (PubChem CID 86116848) has the molecular formula C10H10BrN3O and a molecular weight of 268.11 g/mol. Its IUPAC name is N-[2-(3-bromophenyl)-3,4-dihydropyrazol-5-yl]formamide.
| Compound Name | N-[2-(3-bromophenyl)-3,4-dihydropyrazol-5-yl]formamide |
|---|---|
| PubChem CID | 86116848 |
| Molecular Formula | C10H10BrN3O |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 267.00 |
| IUPAC Name | N-[2-(3-bromophenyl)-3,4-dihydropyrazol-5-yl]formamide |
| SMILES | O=CNC1=NN(c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C10H10BrN3O/c11-8-2-1-3-9(6-8)14-5-4-10(13-14)12-7-15/h1-3,6-7H,4-5H2,(H,12,13,15) |
| InChIKey | DOCIPXLJJFTGDG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|