C21H22N2O2 — CID 86118699
2-diazo-1,3-bis(2,4,6-trimethylphenyl)propane-1,3-dione (PubChem CID 86118699) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-diazo-1,3-bis(2,4,6-trimethylphenyl)propane-1,3-dione.
| Compound Name | 2-diazo-1,3-bis(2,4,6-trimethylphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 86118699 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 2-diazo-1,3-bis(2,4,6-trimethylphenyl)propane-1,3-dione |
| SMILES | Cc1cc(C)c(C(=O)C(=[N+]=[N-])C(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C21H22N2O2/c1-11-7-13(3)17(14(4)8-11)20(24)19(23-22)21(25)18-15(5)9-12(2)10-16(18)6/h7-10H,1-6H3 |
| InChIKey | HDHPZJVPVDTSND-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|