C15H14N2O2 — CID 86135324
2-(3-azatricyclo[3.2.1.02,4]octan-3-yl)isoindole-1,3-dione (PubChem CID 86135324) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-(3-azatricyclo[3.2.1.02,4]octan-3-yl)isoindole-1,3-dione.
| Compound Name | 2-(3-azatricyclo[3.2.1.02,4]octan-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 86135324 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-(3-azatricyclo[3.2.1.02,4]octan-3-yl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1N1C2C3CCC(C3)C21 |
| InChI | InChI=1S/C15H14N2O2/c18-14-10-3-1-2-4-11(10)15(19)17(14)16-12-8-5-6-9(7-8)13(12)16/h1-4,8-9,12-13H,5-7H2 |
| InChIKey | HSCBTCGOLGHOMO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 40.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|