C9H13N — CID 86138903
1,2,4-trimethyl-6-methylidenepyridine (PubChem CID 86138903) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is 1,2,4-trimethyl-6-methylidenepyridine.
| Compound Name | 1,2,4-trimethyl-6-methylidenepyridine |
|---|---|
| PubChem CID | 86138903 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 1,2,4-trimethyl-6-methylidenepyridine |
| SMILES | C=C1C=C(C)C=C(C)N1C |
| InChI | InChI=1S/C9H13N/c1-7-5-8(2)10(4)9(3)6-7/h5-6H,2H2,1,3-4H3 |
| InChIKey | JVHCYDJINBLKPC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |