C9H12N2 — CID 86146738
1,4-dimethyl-6,7-dihydropyrrolo[3,2-c]pyridine (PubChem CID 86146738) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 1,4-dimethyl-6,7-dihydropyrrolo[3,2-c]pyridine.
| Compound Name | 1,4-dimethyl-6,7-dihydropyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 86146738 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 1,4-dimethyl-6,7-dihydropyrrolo[3,2-c]pyridine |
| SMILES | CC1=NCCc2c1ccn2C |
| InChI | InChI=1S/C9H12N2/c1-7-8-4-6-11(2)9(8)3-5-10-7/h4,6H,3,5H2,1-2H3 |
| InChIKey | PGMYSTNQWWDEEM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |