C12H15BrO3 — CID 86149517
3-(bromomethyl)-3-(4-methoxyphenyl)-4,4-dimethyldioxetane (PubChem CID 86149517) has the molecular formula C12H15BrO3 and a molecular weight of 287.15 g/mol. Its IUPAC name is 3-(bromomethyl)-3-(4-methoxyphenyl)-4,4-dimethyldioxetane.
| Compound Name | 3-(bromomethyl)-3-(4-methoxyphenyl)-4,4-dimethyldioxetane |
|---|---|
| PubChem CID | 86149517 |
| Molecular Formula | C12H15BrO3 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 3-(bromomethyl)-3-(4-methoxyphenyl)-4,4-dimethyldioxetane |
| SMILES | COc1ccc(C2(CBr)OOC2(C)C)cc1 |
| InChI | InChI=1S/C12H15BrO3/c1-11(2)12(8-13,16-15-11)9-4-6-10(14-3)7-5-9/h4-7H,8H2,1-3H3 |
| InChIKey | FRVHRPSQKSNLCN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|