(2-cyanophenyl)methyl 2-(5-chloro-2-methoxyphenyl)acetate

C17H14ClNO3 — CID 8616446

IUPAC(2-cyanophenyl)methyl 2-(5-chloro-2-methoxyphenyl)acetate
SMILESCOc1ccc(Cl)cc1CC(=O)OCc1ccccc1C#N
InChIInChI=1S/C17H14ClNO3/c1-21-16-7-6-15(18)8-14(16)9-17(20)22-11-13-5-3-2-4-12(13)10-19/h2-8H,9,11H2,1H3
InChIKeyBZKDSWPMCNPAPZ-UHFFFAOYSA-N
MW315.76 g/mol
LogP3.51
Rot. Bonds5

About (2-cyanophenyl)methyl 2-(5-chloro-2-methoxyphenyl)acetate

(2-cyanophenyl)methyl 2-(5-chloro-2-methoxyphenyl)acetate (PubChem CID 8616446) has the molecular formula C17H14ClNO3 and a molecular weight of 315.76 g/mol. Its IUPAC name is (2-cyanophenyl)methyl 2-(5-chloro-2-methoxyphenyl)acetate.

Molecular Properties

Compound Name(2-cyanophenyl)methyl 2-(5-chloro-2-methoxyphenyl)acetate
PubChem CID8616446
Molecular FormulaC17H14ClNO3
Molecular Weight315.76 g/mol
Exact Mass315.07
IUPAC Name(2-cyanophenyl)methyl 2-(5-chloro-2-methoxyphenyl)acetate
SMILESCOc1ccc(Cl)cc1CC(=O)OCc1ccccc1C#N
InChIInChI=1S/C17H14ClNO3/c1-21-16-7-6-15(18)8-14(16)9-17(20)22-11-13-5-3-2-4-12(13)10-19/h2-8H,9,11H2,1H3
InChIKeyBZKDSWPMCNPAPZ-UHFFFAOYSA-N
XLogP3.51
TPSA59.32 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500315.76
LogP ≤ 53.51
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (2-cyanophenyl)methyl 2-(5-chloro-2-methoxyphenyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-cyanophenyl)methyl 2-(5-chloro-2-methoxyphenyl)acetate?
The IUPAC name of (2-cyanophenyl)methyl 2-(5-chloro-2-methoxyphenyl)acetate (CID 8616446) is (2-cyanophenyl)methyl 2-(5-chloro-2-methoxyphenyl)acetate.
What is the SMILES notation for (2-cyanophenyl)methyl 2-(5-chloro-2-methoxyphenyl)acetate?
The canonical SMILES for (2-cyanophenyl)methyl 2-(5-chloro-2-methoxyphenyl)acetate is COc1ccc(Cl)cc1CC(=O)OCc1ccccc1C#N.
What is the InChIKey of (2-cyanophenyl)methyl 2-(5-chloro-2-methoxyphenyl)acetate?
The InChIKey is BZKDSWPMCNPAPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClNO3/c1-21-16-7-6-15(18)8-14(16)9-17(20)22-11-13-5-3-2-4-12(13)10-19/h2-8H,9,11H2,1H3.
What are the key properties of (2-cyanophenyl)methyl 2-(5-chloro-2-methoxyphenyl)acetate?
(2-cyanophenyl)methyl 2-(5-chloro-2-methoxyphenyl)acetate has a molecular weight of 315.76 g/mol, XLogP of 3.51, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyanophenyl)methyl 2-(5-chloro-2-methoxyphenyl)acetate is sourced from PubChem (CID 8616446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).