C9H9BrCl2 — CID 86177885
1-bromo-4-(2,3-dichloropropyl)benzene (PubChem CID 86177885) has the molecular formula C9H9BrCl2 and a molecular weight of 267.98 g/mol. Its IUPAC name is 1-bromo-4-(2,3-dichloropropyl)benzene.
| Compound Name | 1-bromo-4-(2,3-dichloropropyl)benzene |
|---|---|
| PubChem CID | 86177885 |
| Molecular Formula | C9H9BrCl2 |
| Molecular Weight | 267.98 g/mol |
| Exact Mass | 265.93 |
| IUPAC Name | 1-bromo-4-(2,3-dichloropropyl)benzene |
| SMILES | ClCC(Cl)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C9H9BrCl2/c10-8-3-1-7(2-4-8)5-9(12)6-11/h1-4,9H,5-6H2 |
| InChIKey | DFMPMGJHJDVGAD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.98 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|